C15H15ClN2 — CID 141186204
N,1-diphenyl-2H-azet-4-amine;hydrochloride (PubChem CID 141186204) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is N,1-diphenyl-2H-azet-4-amine;hydrochloride.
| Compound Name | N,1-diphenyl-2H-azet-4-amine;hydrochloride |
|---|---|
| PubChem CID | 141186204 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N,1-diphenyl-2H-azet-4-amine;hydrochloride |
| SMILES | C1=C(Nc2ccccc2)N(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C15H14N2.ClH/c1-3-7-13(8-4-1)16-15-11-12-17(15)14-9-5-2-6-10-14;/h1-11,16H,12H2;1H |
| InChIKey | QIQWEMGDMFSLPG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |