C17H11BrN2O3S2 — CID 2048490
2-bromo-N-[(5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 2048490) has the molecular formula C17H11BrN2O3S2 and a molecular weight of 435.32 g/mol. Its IUPAC name is 2-bromo-N-[(5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-bromo-N-[(5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 2048490 |
| Molecular Formula | C17H11BrN2O3S2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | 2-bromo-N-[(5Z)-5-[(E)-3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C/C=C/c2ccco2)SC1=S)c1ccccc1Br |
| InChI | InChI=1S/C17H11BrN2O3S2/c18-13-8-2-1-7-12(13)15(21)19-20-16(22)14(25-17(20)24)9-3-5-11-6-4-10-23-11/h1-10H,(H,19,21)/b5-3+,14-9- |
| InChIKey | UEPZMBBJZKZQCH-OXTPFRESSA-N |
| XLogP | 4.14 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|