C13H26N2 — CID 20501062
2-ethyl-2,6,6-trimethyl-1-prop-2-enylpiperidin-4-amine (PubChem CID 20501062) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 2-ethyl-2,6,6-trimethyl-1-prop-2-enylpiperidin-4-amine.
| Compound Name | 2-ethyl-2,6,6-trimethyl-1-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 20501062 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-ethyl-2,6,6-trimethyl-1-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN1C(C)(C)CC(N)CC1(C)CC |
| InChI | InChI=1S/C13H26N2/c1-6-8-15-12(3,4)9-11(14)10-13(15,5)7-2/h6,11H,1,7-10,14H2,2-5H3 |
| InChIKey | PVUSXHLOKVKYEU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|