C19H29N3O2 — CID 20511434
2,5-dibutoxy-4-diazo-1-phenylpiperidine (PubChem CID 20511434) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2,5-dibutoxy-4-diazo-1-phenylpiperidine.
| Compound Name | 2,5-dibutoxy-4-diazo-1-phenylpiperidine |
|---|---|
| PubChem CID | 20511434 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2,5-dibutoxy-4-diazo-1-phenylpiperidine |
| SMILES | CCCCOC1CN(c2ccccc2)C(OCCCC)CC1=[N+]=[N-] |
| InChI | InChI=1S/C19H29N3O2/c1-3-5-12-23-18-15-22(16-10-8-7-9-11-16)19(14-17(18)21-20)24-13-6-4-2/h7-11,18-19H,3-6,12-15H2,1-2H3 |
| InChIKey | MXAIGYGUBFHZGT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|