C15H19N2O7S- — CID 2051386
3-[4-[(2R)-2-hydroxy-3-sulfonatopropyl]piperazin-4-ium-1-carbonyl]benzoate (PubChem CID 2051386) has the molecular formula C15H19N2O7S- and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-[4-[(2R)-2-hydroxy-3-sulfonatopropyl]piperazin-4-ium-1-carbonyl]benzoate.
| Compound Name | 3-[4-[(2R)-2-hydroxy-3-sulfonatopropyl]piperazin-4-ium-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 2051386 |
| Molecular Formula | C15H19N2O7S- |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-[4-[(2R)-2-hydroxy-3-sulfonatopropyl]piperazin-4-ium-1-carbonyl]benzoate |
| SMILES | O=C([O-])c1cccc(C(=O)N2CC[NH+](C[C@@H](O)CS(=O)(=O)[O-])CC2)c1 |
| InChI | InChI=1S/C15H20N2O7S/c18-13(10-25(22,23)24)9-16-4-6-17(7-5-16)14(19)11-2-1-3-12(8-11)15(20)21/h1-3,8,13,18H,4-7,9-10H2,(H,20,21)(H,22,23,24)/p-1/t13-/m1/s1 |
| InChIKey | AJIGYZZQIHRLJT-CYBMUJFWSA-M |
| XLogP | -3.70 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|