C9H16N4O — CID 20518312
(NE)-N-[1-(3-ethyl-1,2,4-triazol-1-yl)-2,2-dimethylpropylidene]hydroxylamine (PubChem CID 20518312) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is (NE)-N-[1-(3-ethyl-1,2,4-triazol-1-yl)-2,2-dimethylpropylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(3-ethyl-1,2,4-triazol-1-yl)-2,2-dimethylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 20518312 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (NE)-N-[1-(3-ethyl-1,2,4-triazol-1-yl)-2,2-dimethylpropylidene]hydroxylamine |
| SMILES | CCc1ncn(/C(=N/O)C(C)(C)C)n1 |
| InChI | InChI=1S/C9H16N4O/c1-5-7-10-6-13(11-7)8(12-14)9(2,3)4/h6,14H,5H2,1-4H3/b12-8+ |
| InChIKey | CLYUJJIRELTODB-XYOKQWHBSA-N |
| XLogP | 1.52 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|