C19H28O5 — CID 20522788
2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethanol (PubChem CID 20522788) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethanol.
| Compound Name | 2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 20522788 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethanol |
| SMILES | COc1cc2c(cc1OC)C(COCCO)OCC1(CCCC1)C2 |
| InChI | InChI=1S/C19H28O5/c1-21-16-9-14-11-19(5-3-4-6-19)13-24-18(12-23-8-7-20)15(14)10-17(16)22-2/h9-10,18,20H,3-8,11-13H2,1-2H3 |
| InChIKey | JVFLYLACTLRDAL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|