C14H19BrO5 — CID 21319865
1-(bromomethyl)-3,3,6,7-tetramethoxy-1,4-dihydroisochromene (PubChem CID 21319865) has the molecular formula C14H19BrO5 and a molecular weight of 347.21 g/mol. Its IUPAC name is 1-(bromomethyl)-3,3,6,7-tetramethoxy-1,4-dihydroisochromene.
| Compound Name | 1-(bromomethyl)-3,3,6,7-tetramethoxy-1,4-dihydroisochromene |
|---|---|
| PubChem CID | 21319865 |
| Molecular Formula | C14H19BrO5 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-(bromomethyl)-3,3,6,7-tetramethoxy-1,4-dihydroisochromene |
| SMILES | COc1cc2c(cc1OC)C(CBr)OC(OC)(OC)C2 |
| InChI | InChI=1S/C14H19BrO5/c1-16-11-5-9-7-14(18-3,19-4)20-13(8-15)10(9)6-12(11)17-2/h5-6,13H,7-8H2,1-4H3 |
| InChIKey | JDKJURGVUQCCRL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|