C25H31NO9S — CID 20522779
2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate (PubChem CID 20522779) has the molecular formula C25H31NO9S and a molecular weight of 521.59 g/mol. Its IUPAC name is 2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate.
| Compound Name | 2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 20522779 |
| Molecular Formula | C25H31NO9S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[(7,8-dimethoxyspiro[3,5-dihydro-1H-2-benzoxepine-4,1'-cyclopentane]-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate |
| SMILES | COc1cc2c(cc1OC)C(COCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1)OCC1(CCCC1)C2 |
| InChI | InChI=1S/C25H31NO9S/c1-31-22-13-18-15-25(9-3-4-10-25)17-34-24(21(18)14-23(22)32-2)16-33-11-12-35-36(29,30)20-7-5-19(6-8-20)26(27)28/h5-8,13-14,24H,3-4,9-12,15-17H2,1-2H3 |
| InChIKey | ALXKCMADKRERMZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|