C19H20BrNO8S — CID 20523087
2-[(5-bromo-7-hydroxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate (PubChem CID 20523087) has the molecular formula C19H20BrNO8S and a molecular weight of 502.34 g/mol. Its IUPAC name is 2-[(5-bromo-7-hydroxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate.
| Compound Name | 2-[(5-bromo-7-hydroxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 20523087 |
| Molecular Formula | C19H20BrNO8S |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 2-[(5-bromo-7-hydroxy-1,3,4,5-tetrahydro-2-benzoxepin-1-yl)methoxy]ethyl 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OCCOCC2OCCC(Br)c3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C19H20BrNO8S/c20-18-7-8-28-19(16-6-3-14(22)11-17(16)18)12-27-9-10-29-30(25,26)15-4-1-13(2-5-15)21(23)24/h1-6,11,18-19,22H,7-10,12H2 |
| InChIKey | PWZDAPULACHSKI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|