C10H12Cl2OS — CID 20523056
3-(3,4-dichloro-5-methoxyphenyl)propane-1-thiol (PubChem CID 20523056) has the molecular formula C10H12Cl2OS and a molecular weight of 251.18 g/mol. Its IUPAC name is 3-(3,4-dichloro-5-methoxyphenyl)propane-1-thiol.
| Compound Name | 3-(3,4-dichloro-5-methoxyphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 20523056 |
| Molecular Formula | C10H12Cl2OS |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 3-(3,4-dichloro-5-methoxyphenyl)propane-1-thiol |
| SMILES | COc1cc(CCCS)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2OS/c1-13-9-6-7(3-2-4-14)5-8(11)10(9)12/h5-6,14H,2-4H2,1H3 |
| InChIKey | BGZNXKIBGCLSFU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|