C21H22ClNO3 — CID 20529134
2-[[3-[2-(4-chlorophenyl)ethyl]-2-methyl-1H-indol-5-yl]oxy]-2-methylpropanoic acid (PubChem CID 20529134) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 2-[[3-[2-(4-chlorophenyl)ethyl]-2-methyl-1H-indol-5-yl]oxy]-2-methylpropanoic acid.
| Compound Name | 2-[[3-[2-(4-chlorophenyl)ethyl]-2-methyl-1H-indol-5-yl]oxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 20529134 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[[3-[2-(4-chlorophenyl)ethyl]-2-methyl-1H-indol-5-yl]oxy]-2-methylpropanoic acid |
| SMILES | Cc1[nH]c2ccc(OC(C)(C)C(=O)O)cc2c1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO3/c1-13-17(10-6-14-4-7-15(22)8-5-14)18-12-16(9-11-19(18)23-13)26-21(2,3)20(24)25/h4-5,7-9,11-12,23H,6,10H2,1-3H3,(H,24,25) |
| InChIKey | KLZVCRHOWASGFJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|