About 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid
2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid (PubChem CID 20533582) has the molecular formula C8H14N2O5
and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid.
Analyze 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid?
The IUPAC name of 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid (CID 20533582) is 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid.
What is the SMILES notation for 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid?
The canonical SMILES for 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid is O=C(O)CN1CC(O)CN(CC(=O)O)C1.
What is the InChIKey of 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid?
The InChIKey is RAYBLNDHFBIZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O5/c11-6-1-9(3-7(12)13)5-10(2-6)4-8(14)15/h6,11H,1-5H2,(H,12,13)(H,14,15).
What are the key properties of 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid?
2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid has a molecular weight of 218.21 g/mol, XLogP of -1.91, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(carboxymethyl)-5-hydroxy-1,3-diazinan-1-yl]acetic acid is sourced from PubChem (CID 20533582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).