C23H20Cl2FO4Si- — CID 20537139
2-[[6,7-dichloro-2-(4-fluorophenyl)-1-oxo-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate (PubChem CID 20537139) has the molecular formula C23H20Cl2FO4Si- and a molecular weight of 478.40 g/mol. Its IUPAC name is 2-[[6,7-dichloro-2-(4-fluorophenyl)-1-oxo-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate.
| Compound Name | 2-[[6,7-dichloro-2-(4-fluorophenyl)-1-oxo-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 20537139 |
| Molecular Formula | C23H20Cl2FO4Si- |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 2-[[6,7-dichloro-2-(4-fluorophenyl)-1-oxo-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate |
| SMILES | C[Si](C)(C)C#CCC1(c2ccc(F)cc2)Cc2cc(OCC(=O)[O-])c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C23H21Cl2FO4Si/c1-31(2,3)10-4-9-23(15-5-7-16(26)8-6-15)12-14-11-17(30-13-18(27)28)20(24)21(25)19(14)22(23)29/h5-8,11H,9,12-13H2,1-3H3,(H,27,28)/p-1 |
| InChIKey | QGECMCQJXXQJMR-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|