C26H26Cl2O4 — CID 20539883
4-[1-[3,4-bis(prop-2-enoxy)phenyl]-2,2-dichloroethenyl]-1,2-bis(prop-2-enoxy)benzene (PubChem CID 20539883) has the molecular formula C26H26Cl2O4 and a molecular weight of 473.40 g/mol. Its IUPAC name is 4-[1-[3,4-bis(prop-2-enoxy)phenyl]-2,2-dichloroethenyl]-1,2-bis(prop-2-enoxy)benzene.
| Compound Name | 4-[1-[3,4-bis(prop-2-enoxy)phenyl]-2,2-dichloroethenyl]-1,2-bis(prop-2-enoxy)benzene |
|---|---|
| PubChem CID | 20539883 |
| Molecular Formula | C26H26Cl2O4 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 4-[1-[3,4-bis(prop-2-enoxy)phenyl]-2,2-dichloroethenyl]-1,2-bis(prop-2-enoxy)benzene |
| SMILES | C=CCOc1ccc(C(=C(Cl)Cl)c2ccc(OCC=C)c(OCC=C)c2)cc1OCC=C |
| InChI | InChI=1S/C26H26Cl2O4/c1-5-13-29-21-11-9-19(17-23(21)31-15-7-3)25(26(27)28)20-10-12-22(30-14-6-2)24(18-20)32-16-8-4/h5-12,17-18H,1-4,13-16H2 |
| InChIKey | UWQNWMZGKJZZMT-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|