C6H13N2O6P — CID 20550671
2-[2-(phosphonoamino)propanoylamino]propanoic acid (PubChem CID 20550671) has the molecular formula C6H13N2O6P and a molecular weight of 240.15 g/mol. Its IUPAC name is 2-[2-(phosphonoamino)propanoylamino]propanoic acid.
| Compound Name | 2-[2-(phosphonoamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 20550671 |
| Molecular Formula | C6H13N2O6P |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[2-(phosphonoamino)propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C6H13N2O6P/c1-3(8-15(12,13)14)5(9)7-4(2)6(10)11/h3-4H,1-2H3,(H,7,9)(H,10,11)(H3,8,12,13,14) |
| InChIKey | CLIMBNUVYUXMGO-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|