C46H64N2O2S2 — CID 20554130
N,N'-bis(2-methylundecan-2-ylsulfanyl)-N,N'-dinaphthalen-1-yloxamide (PubChem CID 20554130) has the molecular formula C46H64N2O2S2 and a molecular weight of 741.16 g/mol. Its IUPAC name is N,N'-bis(2-methylundecan-2-ylsulfanyl)-N,N'-dinaphthalen-1-yloxamide.
| Compound Name | N,N'-bis(2-methylundecan-2-ylsulfanyl)-N,N'-dinaphthalen-1-yloxamide |
|---|---|
| PubChem CID | 20554130 |
| Molecular Formula | C46H64N2O2S2 |
| Molecular Weight | 741.16 g/mol |
| Exact Mass | 740.44 |
| IUPAC Name | N,N'-bis(2-methylundecan-2-ylsulfanyl)-N,N'-dinaphthalen-1-yloxamide |
| SMILES | CCCCCCCCCC(C)(C)SN(C(=O)C(=O)N(SC(C)(C)CCCCCCCCC)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C46H64N2O2S2/c1-7-9-11-13-15-17-23-35-45(3,4)51-47(41-33-25-29-37-27-19-21-31-39(37)41)43(49)44(50)48(42-34-26-30-38-28-20-22-32-40(38)42)52-46(5,6)36-24-18-16-14-12-10-8-2/h19-22,25-34H,7-18,23-24,35-36H2,1-6H3 |
| InChIKey | OLQKZFDSAAVKOA-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.16 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|