C22H23NO2 — CID 20555060
2-[1-(benzylamino)ethoxy]phenol;bicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 20555060) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[1-(benzylamino)ethoxy]phenol;bicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-[1-(benzylamino)ethoxy]phenol;bicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 20555060 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[1-(benzylamino)ethoxy]phenol;bicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CC(NCc1ccccc1)Oc1ccccc1O.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C15H17NO2.C7H6/c1-12(16-11-13-7-3-2-4-8-13)18-15-10-6-5-9-14(15)17;1-2-4-7-5-6(7)3-1/h2-10,12,16-17H,11H2,1H3;1-4H,5H2 |
| InChIKey | JWCQYZUBMYZRBY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|