C14H8N2 — CID 20558356
2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10,12,14-octaene (PubChem CID 20558356) has the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10,12,14-octaene.
| Compound Name | 2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 20558356 |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2,3-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
| SMILES | c1ccc2c(c1)-c1cccc3cnnc-2c13 |
| InChI | InChI=1S/C14H8N2/c1-2-6-12-10(5-1)11-7-3-4-9-8-15-16-14(12)13(9)11/h1-8H |
| InChIKey | MOTOIKKWEDOTNV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |