C6H11N6O4S+ — CID 20572191
[2,6-diamino-4-(cyclopropylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate (PubChem CID 20572191) has the molecular formula C6H11N6O4S+ and a molecular weight of 263.26 g/mol. Its IUPAC name is [2,6-diamino-4-(cyclopropylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate.
| Compound Name | [2,6-diamino-4-(cyclopropylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 20572191 |
| Molecular Formula | C6H11N6O4S+ |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [2,6-diamino-4-(cyclopropylamino)-1,3,5-triazin-1-ium-1-yl] hydrogen sulfate |
| SMILES | Nc1nc(NC2CC2)nc(N)[n+]1OS(=O)(=O)O |
| InChI | InChI=1S/C6H10N6O4S/c7-4-10-6(9-3-1-2-3)11-5(8)12(4)16-17(13,14)15/h3H,1-2H2,(H5,7,8,9,10,11,13,14,15)/p+1 |
| InChIKey | WNAIOBXDQOLJOX-UHFFFAOYSA-O |
| XLogP | -2.27 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|