C18H21Cl2NOS — CID 20573171
bicyclo[2.2.0]hexa-1(4),2,5-triene;2-[(2,4-dichlorophenyl)methylsulfanyl]-4-(methylamino)butan-2-ol (PubChem CID 20573171) has the molecular formula C18H21Cl2NOS and a molecular weight of 370.35 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1(4),2,5-triene;2-[(2,4-dichlorophenyl)methylsulfanyl]-4-(methylamino)butan-2-ol.
| Compound Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;2-[(2,4-dichlorophenyl)methylsulfanyl]-4-(methylamino)butan-2-ol |
|---|---|
| PubChem CID | 20573171 |
| Molecular Formula | C18H21Cl2NOS |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | bicyclo[2.2.0]hexa-1(4),2,5-triene;2-[(2,4-dichlorophenyl)methylsulfanyl]-4-(methylamino)butan-2-ol |
| SMILES | CNCCC(C)(O)SCc1ccc(Cl)cc1Cl.c1cc2ccc1=2 |
| InChI | InChI=1S/C12H17Cl2NOS.C6H4/c1-12(16,5-6-15-2)17-8-9-3-4-10(13)7-11(9)14;1-2-6-4-3-5(1)6/h3-4,7,15-16H,5-6,8H2,1-2H3;1-4H |
| InChIKey | WIKGHROBSCDWOT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|