C9H8F9NO2 — CID 20593125
3,3,3-trifluoro-N-prop-2-enyl-2-(1,1,2-trifluoroethoxy)-2-(trifluoromethyl)propanamide (PubChem CID 20593125) has the molecular formula C9H8F9NO2 and a molecular weight of 333.15 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-prop-2-enyl-2-(1,1,2-trifluoroethoxy)-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-prop-2-enyl-2-(1,1,2-trifluoroethoxy)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 20593125 |
| Molecular Formula | C9H8F9NO2 |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3,3,3-trifluoro-N-prop-2-enyl-2-(1,1,2-trifluoroethoxy)-2-(trifluoromethyl)propanamide |
| SMILES | C=CCNC(=O)C(OC(F)(F)CF)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F9NO2/c1-2-3-19-5(20)7(8(13,14)15,9(16,17)18)21-6(11,12)4-10/h2H,1,3-4H2,(H,19,20) |
| InChIKey | PDWYXPIBAADYTM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|