C25H34NO2P — CID 20596637
[2,6-dimethyl-4-(2-methyl-4,5-dihydro-1,3-oxazol-4-yl)heptan-4-yl]oxy-diphenylphosphane (PubChem CID 20596637) has the molecular formula C25H34NO2P and a molecular weight of 411.53 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-methyl-4,5-dihydro-1,3-oxazol-4-yl)heptan-4-yl]oxy-diphenylphosphane.
| Compound Name | [2,6-dimethyl-4-(2-methyl-4,5-dihydro-1,3-oxazol-4-yl)heptan-4-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 20596637 |
| Molecular Formula | C25H34NO2P |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | [2,6-dimethyl-4-(2-methyl-4,5-dihydro-1,3-oxazol-4-yl)heptan-4-yl]oxy-diphenylphosphane |
| SMILES | CC1=NC(C(CC(C)C)(CC(C)C)OP(c2ccccc2)c2ccccc2)CO1 |
| InChI | InChI=1S/C25H34NO2P/c1-19(2)16-25(17-20(3)4,24-18-27-21(5)26-24)28-29(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,19-20,24H,16-18H2,1-5H3 |
| InChIKey | ILKBXDBEEFWJAG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|