C30H44NO4P — CID 143349373
tert-butyl ethyl [2-methyl-4-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite (PubChem CID 143349373) has the molecular formula C30H44NO4P and a molecular weight of 513.66 g/mol. Its IUPAC name is tert-butyl ethyl [2-methyl-4-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite.
| Compound Name | tert-butyl ethyl [2-methyl-4-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite |
|---|---|
| PubChem CID | 143349373 |
| Molecular Formula | C30H44NO4P |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | tert-butyl ethyl [2-methyl-4-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite |
| SMILES | CCOP(OCC1(CCc2ccc(CCCCc3ccc(C)cc3)cc2)COC(C)=N1)OC(C)(C)C |
| InChI | InChI=1S/C30H44NO4P/c1-7-33-36(35-29(4,5)6)34-23-30(22-32-25(3)31-30)21-20-28-18-16-27(17-19-28)11-9-8-10-26-14-12-24(2)13-15-26/h12-19H,7-11,20-23H2,1-6H3 |
| InChIKey | XIQRMBMXCUPTRB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|