C25H22BrCl2IN2O — CID 20601082
1-[(3-benzyl-2,4-dichlorophenyl)methyl]-3-(4-bromophenyl)-5-(iodomethyl)-1,3-diazinan-2-one (PubChem CID 20601082) has the molecular formula C25H22BrCl2IN2O and a molecular weight of 644.18 g/mol. Its IUPAC name is 1-[(3-benzyl-2,4-dichlorophenyl)methyl]-3-(4-bromophenyl)-5-(iodomethyl)-1,3-diazinan-2-one.
| Compound Name | 1-[(3-benzyl-2,4-dichlorophenyl)methyl]-3-(4-bromophenyl)-5-(iodomethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 20601082 |
| Molecular Formula | C25H22BrCl2IN2O |
| Molecular Weight | 644.18 g/mol |
| Exact Mass | 641.93 |
| IUPAC Name | 1-[(3-benzyl-2,4-dichlorophenyl)methyl]-3-(4-bromophenyl)-5-(iodomethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N(Cc2ccc(Cl)c(Cc3ccccc3)c2Cl)CC(CI)CN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22BrCl2IN2O/c26-20-7-9-21(10-8-20)31-15-18(13-29)14-30(25(31)32)16-19-6-11-23(27)22(24(19)28)12-17-4-2-1-3-5-17/h1-11,18H,12-16H2 |
| InChIKey | SPQWDLSCIMMCDD-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.18 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|