C14H24N6 — CID 20609172
1-(N'-benzylcarbamimidoyl)-2-[3-(dimethylamino)propyl]guanidine (PubChem CID 20609172) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 1-(N'-benzylcarbamimidoyl)-2-[3-(dimethylamino)propyl]guanidine.
| Compound Name | 1-(N'-benzylcarbamimidoyl)-2-[3-(dimethylamino)propyl]guanidine |
|---|---|
| PubChem CID | 20609172 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-(N'-benzylcarbamimidoyl)-2-[3-(dimethylamino)propyl]guanidine |
| SMILES | CN(C)CCC/N=C(\N)N/C(N)=N/Cc1ccccc1 |
| InChI | InChI=1S/C14H24N6/c1-20(2)10-6-9-17-13(15)19-14(16)18-11-12-7-4-3-5-8-12/h3-5,7-8H,6,9-11H2,1-2H3,(H5,15,16,17,18,19) |
| InChIKey | WYDWRRLJIUSSST-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|