C20H25N2O7S2+ — CID 20610503
3-[2-methyl-9-[3-(trihydroxy-λ4-sulfanyl)propyl]-[1,3]oxazolo[5,4-b]carbazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 20610503) has the molecular formula C20H25N2O7S2+ and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-[2-methyl-9-[3-(trihydroxy-λ4-sulfanyl)propyl]-[1,3]oxazolo[5,4-b]carbazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-methyl-9-[3-(trihydroxy-λ4-sulfanyl)propyl]-[1,3]oxazolo[5,4-b]carbazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20610503 |
| Molecular Formula | C20H25N2O7S2+ |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-[2-methyl-9-[3-(trihydroxy-λ4-sulfanyl)propyl]-[1,3]oxazolo[5,4-b]carbazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | Cc1oc2cc3c(cc2[n+]1CCCS(=O)(=O)O)c1ccccc1n3CCCS(O)(O)O |
| InChI | InChI=1S/C20H24N2O7S2/c1-14-21(8-4-10-30(23,24)25)19-12-16-15-6-2-3-7-17(15)22(9-5-11-31(26,27)28)18(16)13-20(19)29-14/h2-3,6-7,12-13H,4-5,8-11H2,1H3,(H3-,23,24,25,26,27,28)/p+1 |
| InChIKey | ZTGHJIXVWBAESD-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|