C48H58 — CID 20612915
[2-(2,4-dimethyl-2,4-diphenylpentyl)-5,7-dimethyl-5,7-diphenylnonan-2-yl]benzene (PubChem CID 20612915) has the molecular formula C48H58 and a molecular weight of 634.99 g/mol. Its IUPAC name is [2-(2,4-dimethyl-2,4-diphenylpentyl)-5,7-dimethyl-5,7-diphenylnonan-2-yl]benzene.
| Compound Name | [2-(2,4-dimethyl-2,4-diphenylpentyl)-5,7-dimethyl-5,7-diphenylnonan-2-yl]benzene |
|---|---|
| PubChem CID | 20612915 |
| Molecular Formula | C48H58 |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 634.45 |
| IUPAC Name | [2-(2,4-dimethyl-2,4-diphenylpentyl)-5,7-dimethyl-5,7-diphenylnonan-2-yl]benzene |
| SMILES | CCC(C)(CC(C)(CCC(C)(CC(C)(CC(C)(C)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H58/c1-8-45(4,40-26-16-10-17-27-40)37-46(5,41-28-18-11-19-29-41)34-35-47(6,42-30-20-12-21-31-42)38-48(7,43-32-22-13-23-33-43)36-44(2,3)39-24-14-9-15-25-39/h9-33H,8,34-38H2,1-7H3 |
| InChIKey | ATTKHAFZCHMCBP-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |