C18H9N3 — CID 20612939
2-[(E)-3-[bis(hexa-1,2,3,4,5-pentaenyl)amino]prop-2-enylidene]propanedinitrile (PubChem CID 20612939) has the molecular formula C18H9N3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[(E)-3-[bis(hexa-1,2,3,4,5-pentaenyl)amino]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[bis(hexa-1,2,3,4,5-pentaenyl)amino]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 20612939 |
| Molecular Formula | C18H9N3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[(E)-3-[bis(hexa-1,2,3,4,5-pentaenyl)amino]prop-2-enylidene]propanedinitrile |
| SMILES | C=C=C=C=C=CN(C=C=C=C=C=C)/C=C/C=C(C#N)C#N |
| InChI | InChI=1S/C18H9N3/c1-3-5-7-9-13-21(14-10-8-6-4-2)15-11-12-18(16-19)17-20/h11-15H,1-2H2/b15-11+ |
| InChIKey | QMWNPFXCZOTAOP-RVDMUPIBSA-N |
| XLogP | 3.30 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|