C22H37N3 — CID 25093776
2-[(E)-3-[bis(2-ethylhexyl)amino]prop-2-enylidene]propanedinitrile (PubChem CID 25093776) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is 2-[(E)-3-[bis(2-ethylhexyl)amino]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[bis(2-ethylhexyl)amino]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 25093776 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 2-[(E)-3-[bis(2-ethylhexyl)amino]prop-2-enylidene]propanedinitrile |
| SMILES | CCCCC(CC)CN(/C=C/C=C(C#N)C#N)CC(CC)CCCC |
| InChI | InChI=1S/C22H37N3/c1-5-9-12-20(7-3)18-25(15-11-14-22(16-23)17-24)19-21(8-4)13-10-6-2/h11,14-15,20-21H,5-10,12-13,18-19H2,1-4H3/b15-11+ |
| InChIKey | AGFILONIPSZPFJ-RVDMUPIBSA-N |
| XLogP | 6.21 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|