C11H12F6O4 — CID 20615534
tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(trifluoromethyl)propanoate (PubChem CID 20615534) has the molecular formula C11H12F6O4 and a molecular weight of 322.20 g/mol. Its IUPAC name is tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(trifluoromethyl)propanoate.
| Compound Name | tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 20615534 |
| Molecular Formula | C11H12F6O4 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(trifluoromethyl)propanoate |
| SMILES | C=CC(=O)OC(C(=O)OC(C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O4/c1-5-6(18)20-9(10(12,13)14,11(15,16)17)7(19)21-8(2,3)4/h5H,1H2,2-4H3 |
| InChIKey | ODCNUGMZTJLYGG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|