C13H11F13O4 — CID 20802386
tert-butyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate (PubChem CID 20802386) has the molecular formula C13H11F13O4 and a molecular weight of 478.20 g/mol. Its IUPAC name is tert-butyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate.
| Compound Name | tert-butyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 20802386 |
| Molecular Formula | C13H11F13O4 |
| Molecular Weight | 478.20 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | tert-butyl 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propoxy]propanoate |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H11F13O4/c1-5(14)9(16,17)30-10(18,12(22,23)24)13(25,26)29-8(15,11(19,20)21)6(27)28-7(2,3)4/h1H2,2-4H3 |
| InChIKey | MINGZDMHCLCFJT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.20 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |