C14H13N3O4S-2 — CID 2061744
4-[[(1R)-1-carboxylato-3-methylsulfanylpropyl]amino]quinazoline-7-carboxylate (PubChem CID 2061744) has the molecular formula C14H13N3O4S-2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-[[(1R)-1-carboxylato-3-methylsulfanylpropyl]amino]quinazoline-7-carboxylate.
| Compound Name | 4-[[(1R)-1-carboxylato-3-methylsulfanylpropyl]amino]quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 2061744 |
| Molecular Formula | C14H13N3O4S-2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-[[(1R)-1-carboxylato-3-methylsulfanylpropyl]amino]quinazoline-7-carboxylate |
| SMILES | CSCC[C@@H](Nc1ncnc2cc(C(=O)[O-])ccc12)C(=O)[O-] |
| InChI | InChI=1S/C14H15N3O4S/c1-22-5-4-10(14(20)21)17-12-9-3-2-8(13(18)19)6-11(9)15-7-16-12/h2-3,6-7,10H,4-5H2,1H3,(H,18,19)(H,20,21)(H,15,16,17)/p-2/t10-/m1/s1 |
| InChIKey | SRSOTTUAZBPKTE-SNVBAGLBSA-L |
| XLogP | -0.72 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |