C13H21N2O5S- — CID 20623462
N-[2-(4-carboxy-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 20623462) has the molecular formula C13H21N2O5S- and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[2-(4-carboxy-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | N-[2-(4-carboxy-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 20623462 |
| Molecular Formula | C13H21N2O5S- |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[2-(4-carboxy-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=O)N1C(C(=O)O)CSC1(C)C |
| InChI | InChI=1S/C13H22N2O5S/c1-12(2,3)20-11(19)14-6-9(16)15-8(10(17)18)7-21-13(15,4)5/h8H,6-7H2,1-5H3,(H,14,19)(H,17,18)/p-1 |
| InChIKey | YSNNIVFFZPHHNJ-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|