C11H17N2O5S- — CID 59927158
N-[2-[(4R)-4-carboxy-1,3-thiazolidin-3-yl]-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 59927158) has the molecular formula C11H17N2O5S- and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-[(4R)-4-carboxy-1,3-thiazolidin-3-yl]-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | N-[2-[(4R)-4-carboxy-1,3-thiazolidin-3-yl]-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 59927158 |
| Molecular Formula | C11H17N2O5S- |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-[(4R)-4-carboxy-1,3-thiazolidin-3-yl]-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=O)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-11(2,3)18-10(17)12-4-8(14)13-6-19-5-7(13)9(15)16/h7H,4-6H2,1-3H3,(H,12,17)(H,15,16)/p-1/t7-/m0/s1 |
| InChIKey | RTANZWODNKJUMI-ZETCQYMHSA-M |
| XLogP | -0.50 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|