C11H17N2O3S2- — CID 59927166
N-[2-[(2R)-2-formyl-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 59927166) has the molecular formula C11H17N2O3S2- and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[2-[(2R)-2-formyl-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | N-[2-[(2R)-2-formyl-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 59927166 |
| Molecular Formula | C11H17N2O3S2- |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[2-[(2R)-2-formyl-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=S)N1CCS[C@@H]1C=O |
| InChI | InChI=1S/C11H18N2O3S2/c1-11(2,3)16-10(15)12-6-8(17)13-4-5-18-9(13)7-14/h7,9H,4-6H2,1-3H3,(H,12,15)/p-1/t9-/m1/s1 |
| InChIKey | MRZOUMUMCGPRKI-SECBINFHSA-M |
| XLogP | 0.42 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|