C12H21N2O2S2- — CID 59927204
1-[(2-methylpropan-2-yl)oxy]-N-[2-sulfanylidene-2-[(2S)-2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]methanimidate (PubChem CID 59927204) has the molecular formula C12H21N2O2S2- and a molecular weight of 289.45 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]-N-[2-sulfanylidene-2-[(2S)-2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]methanimidate.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]-N-[2-sulfanylidene-2-[(2S)-2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]methanimidate |
|---|---|
| PubChem CID | 59927204 |
| Molecular Formula | C12H21N2O2S2- |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]-N-[2-sulfanylidene-2-[(2S)-2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=S)N1CCC[C@H]1CS |
| InChI | InChI=1S/C12H22N2O2S2/c1-12(2,3)16-11(15)13-7-10(18)14-6-4-5-9(14)8-17/h9,17H,4-8H2,1-3H3,(H,13,15)/p-1/t9-/m0/s1 |
| InChIKey | FYUNGIYLPUGVNX-VIFPVBQESA-M |
| XLogP | 1.24 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|