C12H21N2O3S- — CID 59926913
N-[2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 59926913) has the molecular formula C12H21N2O3S- and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | N-[2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 59926913 |
| Molecular Formula | C12H21N2O3S- |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=S)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C12H22N2O3S/c1-12(2,3)17-11(16)13-7-10(18)14-6-4-5-9(14)8-15/h9,15H,4-8H2,1-3H3,(H,13,16)/p-1/t9-/m1/s1 |
| InChIKey | BZQVYGFXBGSFTR-SECBINFHSA-M |
| XLogP | 0.30 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|