C13H23N2O2S3- — CID 20623431
N-[2-[4,4-dimethyl-2-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 20623431) has the molecular formula C13H23N2O2S3- and a molecular weight of 335.54 g/mol. Its IUPAC name is N-[2-[4,4-dimethyl-2-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | N-[2-[4,4-dimethyl-2-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 20623431 |
| Molecular Formula | C13H23N2O2S3- |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[2-[4,4-dimethyl-2-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-sulfanylideneethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=S)N1C(CS)SCC1(C)C |
| InChI | InChI=1S/C13H24N2O2S3/c1-12(2,3)17-11(16)14-6-9(19)15-10(7-18)20-8-13(15,4)5/h10,18H,6-8H2,1-5H3,(H,14,16)/p-1 |
| InChIKey | VZFHYBWAJMWYIQ-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|