C8H14NO3- — CID 59351911
1-[(2-methylpropan-2-yl)oxy]-N-(oxiran-2-ylmethyl)methanimidate (PubChem CID 59351911) has the molecular formula C8H14NO3- and a molecular weight of 172.20 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxy]-N-(oxiran-2-ylmethyl)methanimidate.
| Compound Name | 1-[(2-methylpropan-2-yl)oxy]-N-(oxiran-2-ylmethyl)methanimidate |
|---|---|
| PubChem CID | 59351911 |
| Molecular Formula | C8H14NO3- |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxy]-N-(oxiran-2-ylmethyl)methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC1CO1 |
| InChI | InChI=1S/C8H15NO3/c1-8(2,3)12-7(10)9-4-6-5-11-6/h6H,4-5H2,1-3H3,(H,9,10)/p-1 |
| InChIKey | ZBBGKXNNTNBRBH-UHFFFAOYSA-M |
| XLogP | -0.08 |
| TPSA | 57.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|