C10H10N3Y+2 — CID 20626534
4,6,7-trimethyl-2H-pyrido[3,2-d]pyrimidin-2-ide;yttrium(3+) (PubChem CID 20626534) has the molecular formula C10H10N3Y+2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 4,6,7-trimethyl-2H-pyrido[3,2-d]pyrimidin-2-ide;yttrium(3+).
| Compound Name | 4,6,7-trimethyl-2H-pyrido[3,2-d]pyrimidin-2-ide;yttrium(3+) |
|---|---|
| PubChem CID | 20626534 |
| Molecular Formula | C10H10N3Y+2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 4,6,7-trimethyl-2H-pyrido[3,2-d]pyrimidin-2-ide;yttrium(3+) |
| SMILES | Cc1cc2n[c-]nc(C)c2nc1C.[Y+3] |
| InChI | InChI=1S/C10H10N3.Y/c1-6-4-9-10(13-7(6)2)8(3)11-5-12-9;/h4H,1-3H3;/q-1;+3 |
| InChIKey | SYXJHLGEWMACSD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|