C13H20N2S — CID 20628520
5,6-ditert-butylimidazo[2,1-b][1,3]thiazole (PubChem CID 20628520) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 5,6-ditert-butylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5,6-ditert-butylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 20628520 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5,6-ditert-butylimidazo[2,1-b][1,3]thiazole |
| SMILES | CC(C)(C)c1nc2sccn2c1C(C)(C)C |
| InChI | InChI=1S/C13H20N2S/c1-12(2,3)9-10(13(4,5)6)15-7-8-16-11(15)14-9/h7-8H,1-6H3 |
| InChIKey | TXMGWYIRRZEGSN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |