C24H32N4O3S — CID 20628841
N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 20628841) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20628841 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | Cc1ccccc1/N=N/c1ccc(NC(=O)C2CCC(NS(=O)(=O)C(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C24H32N4O3S/c1-16(2)32(30,31)28-20-11-9-19(10-12-20)24(29)25-22-14-13-21(15-18(22)4)26-27-23-8-6-5-7-17(23)3/h5-8,13-16,19-20,28H,9-12H2,1-4H3,(H,25,29)/b27-26+ |
| InChIKey | PQTMYOOJJCBZII-CYYJNZCTSA-N |
| XLogP | 5.54 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|