C18H32N4O4S — CID 20630433
N-(4-butoxy-6-methylpyrimidin-2-yl)-5-(tert-butylsulfonylamino)pentanamide (PubChem CID 20630433) has the molecular formula C18H32N4O4S and a molecular weight of 400.55 g/mol. Its IUPAC name is N-(4-butoxy-6-methylpyrimidin-2-yl)-5-(tert-butylsulfonylamino)pentanamide.
| Compound Name | N-(4-butoxy-6-methylpyrimidin-2-yl)-5-(tert-butylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 20630433 |
| Molecular Formula | C18H32N4O4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-(4-butoxy-6-methylpyrimidin-2-yl)-5-(tert-butylsulfonylamino)pentanamide |
| SMILES | CCCCOc1cc(C)nc(NC(=O)CCCCNS(=O)(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C18H32N4O4S/c1-6-7-12-26-16-13-14(2)20-17(22-16)21-15(23)10-8-9-11-19-27(24,25)18(3,4)5/h13,19H,6-12H2,1-5H3,(H,20,21,22,23) |
| InChIKey | GAYBNCKWLWSXSV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|