C20H12O3S — CID 20632467
6,16-dimethyl-10-oxa-20-thiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4(9),5,7,14(19),15,17-octaene-2,12-dione (PubChem CID 20632467) has the molecular formula C20H12O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is 6,16-dimethyl-10-oxa-20-thiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4(9),5,7,14(19),15,17-octaene-2,12-dione.
| Compound Name | 6,16-dimethyl-10-oxa-20-thiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4(9),5,7,14(19),15,17-octaene-2,12-dione |
|---|---|
| PubChem CID | 20632467 |
| Molecular Formula | C20H12O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 6,16-dimethyl-10-oxa-20-thiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),3(11),4(9),5,7,14(19),15,17-octaene-2,12-dione |
| SMILES | Cc1ccc2oc3c(c2c1)C(=O)c1sc2ccc(C)cc2c1C3=O |
| InChI | InChI=1S/C20H12O3S/c1-9-3-5-13-11(7-9)15-18(22)20-16(17(21)19(15)23-13)12-8-10(2)4-6-14(12)24-20/h3-8H,1-2H3 |
| InChIKey | WPQRRZMRTNQEEQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|