C23H32O2 — CID 20638394
(1R,3aR,4S,7aR)-1-[(2R)-4-[2-(2-hydroxypropan-2-yl)phenyl]but-3-yn-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 20638394) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-1-[(2R)-4-[2-(2-hydroxypropan-2-yl)phenyl]but-3-yn-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-1-[(2R)-4-[2-(2-hydroxypropan-2-yl)phenyl]but-3-yn-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 20638394 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1R,3aR,4S,7aR)-1-[(2R)-4-[2-(2-hydroxypropan-2-yl)phenyl]but-3-yn-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C[C@@H](C#Cc1ccccc1C(C)(C)O)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C23H32O2/c1-16(11-12-17-8-5-6-9-19(17)22(2,3)25)18-13-14-20-21(24)10-7-15-23(18,20)4/h5-6,8-9,16,18,20-21,24-25H,7,10,13-15H2,1-4H3/t16-,18+,20-,21-,23+/m0/s1 |
| InChIKey | KJUSYQUOPVQSLV-WVZWDQLJSA-N |
| XLogP | 4.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|