C29H44N10O5 — CID 20641732
3-[[2-[4-[2-(1-carbamimidoylpiperidin-4-yl)ethyl]-2,5-dioxopiperazin-1-yl]acetyl]amino]-6-(diaminomethylideneamino)-2-oxo-N-(2-phenylethyl)hexanamide (PubChem CID 20641732) has the molecular formula C29H44N10O5 and a molecular weight of 612.74 g/mol. Its IUPAC name is 3-[[2-[4-[2-(1-carbamimidoylpiperidin-4-yl)ethyl]-2,5-dioxopiperazin-1-yl]acetyl]amino]-6-(diaminomethylideneamino)-2-oxo-N-(2-phenylethyl)hexanamide.
| Compound Name | 3-[[2-[4-[2-(1-carbamimidoylpiperidin-4-yl)ethyl]-2,5-dioxopiperazin-1-yl]acetyl]amino]-6-(diaminomethylideneamino)-2-oxo-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 20641732 |
| Molecular Formula | C29H44N10O5 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | 3-[[2-[4-[2-(1-carbamimidoylpiperidin-4-yl)ethyl]-2,5-dioxopiperazin-1-yl]acetyl]amino]-6-(diaminomethylideneamino)-2-oxo-N-(2-phenylethyl)hexanamide |
| SMILES | [H]/N=C(\N)N1CCC(CCN2CC(=O)N(CC(=O)NC(CCCN=C(N)N)C(=O)C(=O)NCCc3ccccc3)CC2=O)CC1 |
| InChI | InChI=1S/C29H44N10O5/c30-28(31)35-12-4-7-22(26(43)27(44)34-13-8-20-5-2-1-3-6-20)36-23(40)17-39-19-24(41)38(18-25(39)42)16-11-21-9-14-37(15-10-21)29(32)33/h1-3,5-6,21-22H,4,7-19H2,(H3,32,33)(H,34,44)(H,36,40)(H4,30,31,35) |
| InChIKey | XJWPCIQRSSKLAC-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 233.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|