About 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine
2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine (PubChem CID 20647167) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine.
Analyze 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine?
The IUPAC name of 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine (CID 20647167) is 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine.
What is the SMILES notation for 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine?
The canonical SMILES for 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine is CC1=NCc2c(C)nc(C)nc2C1.
What is the InChIKey of 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine?
The InChIKey is ABTYWAAWKAPIKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-6-4-10-9(5-11-6)7(2)12-8(3)13-10/h4-5H2,1-3H3.
What are the key properties of 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine?
2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine has a molecular weight of 175.23 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,7-trimethyl-5,8-dihydropyrido[4,3-d]pyrimidine is sourced from PubChem (CID 20647167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).