C16H28N4 — CID 11304215
2,4,10,12-tetramethyl-1,5,9,13-tetrazacyclohexadeca-1,4,9,12-tetraene (PubChem CID 11304215) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2,4,10,12-tetramethyl-1,5,9,13-tetrazacyclohexadeca-1,4,9,12-tetraene.
| Compound Name | 2,4,10,12-tetramethyl-1,5,9,13-tetrazacyclohexadeca-1,4,9,12-tetraene |
|---|---|
| PubChem CID | 11304215 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2,4,10,12-tetramethyl-1,5,9,13-tetrazacyclohexadeca-1,4,9,12-tetraene |
| SMILES | C/C1=N/CCC/N=C(\C)C/C(C)=N/CCC/N=C(\C)C1 |
| InChI | InChI=1S/C16H28N4/c1-13-11-14(2)18-9-6-10-20-16(4)12-15(3)19-8-5-7-17-13/h5-12H2,1-4H3/b17-13-,18-14+,19-15+,20-16+ |
| InChIKey | WWGNUCPDCLZGEM-HAXOTXOKSA-N |
| XLogP | 3.40 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |