C11H19N — CID 123924928
4-methyl-3-azaspiro[5.5]undec-3-ene (PubChem CID 123924928) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-methyl-3-azaspiro[5.5]undec-3-ene.
| Compound Name | 4-methyl-3-azaspiro[5.5]undec-3-ene |
|---|---|
| PubChem CID | 123924928 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-methyl-3-azaspiro[5.5]undec-3-ene |
| SMILES | CC1=NCCC2(CCCCC2)C1 |
| InChI | InChI=1S/C11H19N/c1-10-9-11(7-8-12-10)5-3-2-4-6-11/h2-9H2,1H3 |
| InChIKey | LYMMXXRRASFIRS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |